Registration Dossier

Diss Factsheets

IUPAC name:
(2R)-2-amino-2-(cyclohexa-1,4-dien-1-yl)acetic acid

Inventory

EC number:
247-999-1
EC name:
(R)-α-aminocyclohexa-1,4-diene-1-acetic acid
CAS number:
26774-88-9
CAS number:
26774-88-9

Synonyms

Molecular and structural information

Molecular formula:
C8H11NO2
Molecular weight:
ca. 153.2
SMILES notation:
N[C@@H](C(=O)O)C1=CCC=CC1
InChl:
InChI=1/C8H11NO2/c9-7(8(10)11)6-4-2-1-3-5-6/h1-2,5,7H,3-4,9H2,(H,10,11)
Structural formula:
Chemical structure

Related substances