Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3-methoxy-5-methylphenol

Inventory

EC number:
221-716-1
EC name:
3-methoxy-5-methylphenol
CAS number:
3209-13-0
CAS number:
3209-13-0
Synonyms
Names:
Phenol, 3-methoxy-5-methyl-
m-Cresol, 5-methoxy-

Molecular and structural information

Molecular formula:
C8H10O2
Molecular weight:
138.164
SMILES notation:
COc1cc(C)cc(O)c1
InChl:
InChI=1/C8H10O2/c1-6-3-7(9)5-8(4-6)10-2/h3-5,9H,1-2H3
Structural formula:
Chemical structure

Related substances