Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
ethyl 2,4-dihydroxy-6-methylbenzoate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C10H12O4
Molecular weight:
196
SMILES notation:
Oc1cc(O)cc(C)c1C(=O)OCC
InChl:
InChI=1S/C10H12O4/c1-3-14-10(13)9-6(2)4-7(11)5-8(9)12/h4-5,11-12H,3H2,1-2H3
Structural formula:
Chemical structure

Related substances