Registration Dossier

Reference substances

Reference substances

IUPAC name:
2-[4-(1,3-dioxo-2,3-dihydro-1H-isoindol-2-yl)phenyl]butanoic acid

Inventory

EC number:
303-995-2
EC name:
2-[4-(1,3-dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl]butyric acid
CAS number:
94232-67-4
CAS number:
94232-67-4
Synonyms
Names:
Identifier:
IUPAC name
2-(4-(1,3-Dihydro-1,3-dioxo-2H-isoindol-2-yl)phenyl)butyric acid
Identifier:
other: SMILES notation
C([C@@H](CC)c1ccc(cc1)N1C(c2ccccc2C1=O)=O)(=O)O
2-[4-(1,3-dioxo-1,3-dihydro-2H-isoindol-2-yl)phenyl]butanoic acid

Molecular and structural information

Molecular formula:
C18H15NO4
Molecular weight:
309.316
SMILES notation:
CCC(C(=O)O)c1ccc(cc1)N2C(=O)c3ccccc3C2=O
InChl:
InChI=1/C18H15NO4/c1-2-13(18(22)23)11-7-9-12(10-8-11)19-16(20)14-5-3-4-6-15(14)17(19)21/h3-10,13H,2H2,1H3,(H,22,23)
Structural formula:
Chemical structure

Related substances