Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-chloropropanoic acid

Inventory

EC number:
209-952-3
EC name:
2-chloropropionic acid
CAS number:
598-78-7
CAS number:
598-78-7
Synonyms
Names:
Propanoic acid, 2-chloro-

Molecular and structural information

Molecular formula:
C3H5ClO2
Molecular weight:
108.524
SMILES notation:
CC(Cl)C(=O)O
InChl:
InChI=1/C3H5ClO2/c1-2(4)3(5)6/h2H,1H3,(H,5,6)
Structural formula:
Chemical structure

Related substances