Registration Dossier

Diss Factsheets

IUPAC name:
2-(2-bromo-4,5-dimethoxyphenyl)ethan-1-amine hydrobromide

Inventory

CAS number:
164020-79-5

Synonyms

Molecular and structural information

Molecular formula:
C10H15Br2NO2
Molecular weight:
341.04
SMILES notation:
COC1=CC(CCN)=C(Br)C=C1OC.Br
InChl:
InChI=1S/C10H14BrNO2.BrH/c1-13-9-5-7(3-4-12)8(11)6-10(9)14-2;/h5-6H,3-4,12H2,1-2H3;1H
Structural formula:
Chemical structure

Related substances