Registration Dossier

Diss Factsheets

IUPAC name:
1,2-Hydrazinedicarboxylic acid, bis(1-methylethyl) ester

Inventory

EC number:
243-263-9
EC name:
Diisopropyl bicarbamate
CAS number:
19740-72-8
CAS number:
19740-72-8

Synonyms

Molecular and structural information

Molecular formula:
C8H16N2O4
Molecular weight:
204.22
SMILES notation:
O=C(OC(C)C)NNC(=O)OC(C)C
InChl:
InChI=1S/C8H16N2O4/c1-5(2)13-7(11)9-10-8(12)14-6(3)4/h5-6H,1-4H3,(H,9,11)(H,10,12)
Structural formula:
Chemical structure

Related substances

Categories Display