Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Pyrophosphate mixture

Inventory

Synonyms

Molecular and structural information

Molecular formula:
UVCB substance, molecular formula for applicable
Molecular weight:
>= 178 - <= 626
SMILES notation:
R = HEMA: C(=O)(C(=C)C)OCCOP(=O)(OCCOC(=O)C(=C)C)OP(=O)(OCCOC(=O)C(=C)C)OCCOC(=O)C(=C)C
R = H: OP(O)(=O)OP(O)(O)=O

Related substances