Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
{[hydroxy({2-[(2-methylprop-2-enoyl)oxy]ethoxy})phosphoryl]oxy}phosphonic acid

Inventory

Synonyms
Names:
Identifier:
other:
[hydroxy(2-[(2-methylprop-2-enoyl)oxy]ethoxy)phosphoryl]oxyphosphonic acid

Molecular and structural information

Molecular formula:
C6H12O9P2
Molecular weight:
290.101
SMILES notation:
CC(=C)C(=O)OCCOP(O)(=O)OP(O)(O)=O
InChl:
InChI=1/C6H12O9P2/c1-5(2)6(7)13-3-4-14-17(11,12)15-16(8,9)10/h1,3-4H2,2H3,(H,11,12)(H2,8,9,10)
Structural formula:
Chemical structure

Related substances