Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-methylbenzoyl chloride

Inventory

EC number:
212-864-8
EC name:
p-toluoyl chloride
CAS number:
874-60-2
CAS number:
874-60-2
Synonyms
Names:
Benzoyl chloride, 4-methyl-
4-methylbenzoyl chloride

Molecular and structural information

Molecular formula:
C8H7ClO
Molecular weight:
154.594
SMILES notation:
Cc1ccc(cc1)C(=O)Cl
InChl:
InChI=1/C8H7ClO/c1-6-2-4-7(5-3-6)8(9)10/h2-5H,1H3
Structural formula:
Chemical structure

Related substances