Registration Dossier

Reference substances

Reference substances

Currently viewing:

General information

Inventory

EC number:
220-552-8
EC name:
Etidronic acid
CAS number:
2809-21-4

No inventory information available

Reference substance information

IUPAC name:
(1-hydroxyethane-1,1-diyl)bis(phosphonic acid)
Synonyms
Names:
(1-Hydroxyethylidene)-1,1-bis(phosphonic acid)
(1-Hydroxyethylidene)-1,1-diphosphonic acid
(1-Hydroxyethylidene)bisphosphonic acid
(1-Hydroxyethylidene)diphosphonic acid
1-Hydroxy-1,1-diphosphonoethane
1-Hydroxyethane-1,1-bisphosphonic acid
1-Hydroxyethane-1,1-diphosphonic acid
1-Hydroxyethane-1,1-diyldiphosphonic acid
1-Hydroxyethanediphosphonic acid
1-Hydroxyethylidene-1,1'-diphosphonic acid
1-Hydroxyethylidene-1,1-diphoshonic acid
1-Hydroxyethylidene-1,1-diphosphonic acid
1-Hydroxyethylidene-1,1-diphosphoric acid
1-Hydroxyethylidene-1,1-disphosphonic acid
Acetodiphosphonic acid
Acidum etidronicum
Ethane-1-hydroxy-1,1'diphosphonic acid
Ethane-1-hydroxy-1,1-diphosphonic acid
Hydroxyethanediphosphonic acid
Oxyethylidenediphosphonic acid
Phosphonic acid, (1-hydroxyethylidene)bis
Phosphonic acid, (1-hydroxyethylidene)bis-
Phosphonic acid, (1-hydroxyethylidene)di-

CAS information

CAS number:
2809-21-4

Molecular and structural information

Molecular formula:
C2H8O7P2
Molecular weight:
206.028
SMILES notation:
CC(O)(P(=O)(O)O)P(=O)(O)O
InChl:
InChI=1/C2H8O7P2/c1-2(3,10(4,5)6)11(7,8)9/h3H,1H3,(H2,4,5,6)(H2,7,8,9)
Structural formula:
Chemical structure