Registration Dossier

IUPAC name:
2-((6,6-diméthylbicyclo[3.1.1]hept-2-yl)éthoxy)éthyl morpholine

Inventory

CAS number:
38284-47-8

Synonyms

Molecular and structural information

Molecular formula:
C17H31O2N
Molecular weight:
281.4
SMILES notation:
CC1(C2CCC(C1C2)CCOCCN3CCOCC3)C
InChl:
InChI=1S/C17H31NO2/c1-17(2)15-4-3-14(16(17)13-15)5-9-19-10-6-18-7-11-20-12-8-18/h14-16H,3-13H2,1-2H3
Structural formula:
Chemical structure

Related substances