Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
α-phenylpiperidine-2-acetic acid


EC number:
EC name:
α-phenylpiperidine-2-acetic acid
CAS number:
CAS number:
2-Piperidineacetic acid, alpha-phenyl-
IUPAC name
phenyl(piperidin-2-yl)acetic acid
IUPAC name
rac-(2R)-2-Phenyl-2-(piperidin-2-yl)acetic acid
other: SMILES notation
O=C(O)[C@@](C1=CC=CC=C1)([H])C2NCCCC2 AND O=C(O)[C@](C1=CC=CC=C1)([H])C2NCCCC2
2-phenyl-2-(2-piperidyl)acetic acid

Molecular and structural information

Molecular formula:
Molecular weight:
ca. 219.28
SMILES notation:
Structural formula:
Chemical structure

Related substances