Registration Dossier

IUPAC name:
1,3-phenylenebis((4-hydroxyphenyl)methanone)

Inventory

CAS number:
5436-05-5

Synonyms

Molecular and structural information

Molecular formula:
C20H14O4
Molecular weight:
ca. 318.33
SMILES notation:
O=C(c1ccc(O)cc1)c3cccc(C(=O)c2ccc(O)cc2)c3
Structural formula:
Chemical structure

Related substances