Registration Dossier

IUPAC name:
1,3,4,5-tetrahydro-2H-1,5-methano-3-benzazepin-2-one

Inventory

CAS number:
357426-13-2

Synonyms

Molecular and structural information

Molecular formula:
C11H11NO
Molecular weight:
173.211
SMILES notation:
O=C3NCC2CC3c1ccccc12
InChl:
InChI=1S/C11H11NO/c13-11-10-5-7(6-12-11)8-3-1-2-4-9(8)10/h1-4,7,10H,5-6H2,(H,12,13)
Structural formula:
Chemical structure

Related substances