Registration Dossier

IUPAC name:
1,1,1-trifluoro-N-phenylmethanesulfonamide

Inventory

CAS number:
456-64-4

Synonyms

Molecular and structural information

Molecular formula:
C7H6F3NO2S
Molecular weight:
225.185
SMILES notation:
C1=CC=C(C=C1)NS(=O)(=O)C(F)(F)F
Structural formula:
Chemical structure

Related substances