Registration Dossier

Diss Factsheets

IUPAC name:
(2R)-1-(2,4-difluorophenyl)-2-((tetrahydro-2H-pyran-2-yl)oxy)propan-1-one

Inventory

CAS number:
126918-17-0

Synonyms

Molecular and structural information

Molecular formula:
C14H16F2O3
Molecular weight:
270.28
SMILES notation:
C[C@H](C(C1=C(F)C=C(F)C=C1)=O)OC2CCCCO2
Structural formula:
Chemical structure

Related substances