Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-oxopropanoic acid

Inventory

EC number:
204-824-3
EC name:
Pyruvic acid
CAS number:
127-17-3
CAS number:
127-17-3
Synonyms
Names:
Propanoic acid, 2-oxo-
2-oxopropanoic acid

Molecular and structural information

Molecular formula:
C3H4O3
Molecular weight:
88.062
SMILES notation:
CC(=O)C(=O)O
InChl:
InChI=1/C3H4O3/c1-2(4)3(5)6/h1H3,(H,5,6)
Structural formula:
Chemical structure

Related substances