Registration Dossier

Reference substances

Reference substances

IUPAC name:
3,4-dimethoxybenzoic acid

Inventory

EC number:
202-215-7
EC name:
Veratric acid
CAS number:
93-07-2
CAS number:
93-07-2
Synonyms
Names:
Benzoic acid, 3,4-dimethoxy-
3,4-dimethoxybenzoic acid

Molecular and structural information

Molecular formula:
C9H10O4
Molecular weight:
182.173
SMILES notation:
COc1ccc(cc1OC)C(=O)O
InChl:
InChI=1/C9H10O4/c1-12-7-4-3-6(9(10)11)5-8(7)13-2/h3-5H,1-2H3,(H,10,11)
Structural formula:
Chemical structure

Related substances