Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
N-phenylnaphthalen-1-amine

Inventory

EC number:
201-983-0
EC name:
N-1-naphthylaniline
CAS number:
90-30-2
CAS number:
90-30-2
Synonyms
Names:
N-phenylnaphthalen-1-amine

Molecular and structural information

Molecular formula:
C16H13N
Molecular weight:
ca. 219.29
SMILES notation:
C1=CC=C(C=C1)NC2=CC=CC3=CC=CC=C32
Structural formula:
Chemical structure

Related substances