Registration Dossier

Reference substances

Reference substances

IUPAC name:
2-oxobutanedioic acid

Inventory

EC number:
206-329-8
EC name:
Oxalacetic acid
CAS number:
328-42-7
CAS number:
328-42-7
Synonyms
Names:
Butanedioic acid, oxo-
2-oxosuccinic acid

Molecular and structural information

Molecular formula:
C4H4O5
Molecular weight:
132.072
SMILES notation:
OC(=O)CC(=O)C(=O)O
InChl:
InChI=1/C4H4O5/c5-2(4(8)9)1-3(6)7/h1H2,(H,6,7)(H,8,9)
Structural formula:
Chemical structure

Related substances