Registration Dossier

Reference substances

Reference substances

IUPAC name:
4-[(E)-2-(3-carboxy-1-cyano-1-methylpropyl)diazen-1-yl]-4-cyano-4-methylbutanoic acid

Inventory

EC number:
220-135-0
EC name:
4,4'-azobis[4-cyanovaleric] acid
CAS number:
2638-94-0
CAS number:
2638-94-0
Synonyms
Names:
Pentanoic acid, 4,4'-azobis 4-cyano-
Pentanoic acid, 4,4'-azobis[4-cyano-
4,4'-diazene-1,2-diylbis(4-cyanopentanoic acid)

Molecular and structural information

Molecular formula:
C12H16N4O4
Molecular weight:
280.28
SMILES notation:
OC(=O)CCC(C)(N=NC(C)(C#N)CCC(O)=O)C#N
InChl:
InChI=1/C12H16N4O4/c1-11(7-13,5-3-9(17)18)15-16-12(2,8-14)6-4-10(19)20/h3-6H2,1-2H3,(H,17,18)(H,19,20)
Structural formula:
Chemical structure

Related substances