Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
4-hydroxybenzoic acid

Inventory

EC number:
202-804-9
EC name:
4-hydroxybenzoic acid
CAS number:
99-96-7
CAS number:
99-96-7
Synonyms
Names:
Benzoic acid, 4-hydroxy-
Identifier:
IUPAC name
4-hydroxybenzoic acid
4-hydroxybenzoic acid

Molecular and structural information

Molecular formula:
C7H6O3
Molecular weight:
138.121
SMILES notation:
OC(=O)c1ccc(O)cc1
InChl:
InChI=1/C7H6O3/c8-6-3-1-5(2-4-6)7(9)10/h1-4,8H,(H,9,10)
Structural formula:
Chemical structure

Related substances