Registration Dossier

Diss Factsheets

IUPAC name:
1,3-Dichloro-2-(2,4-difluoro-phenyl-propan-2-ol

Inventory

CAS number:
86386-74-5

Synonyms

Molecular and structural information

Molecular formula:
C9H8Cl2F2O
Molecular weight:
241.07
SMILES notation:
Fc1ccc(c(F)c1)C(O)(CCl)CCl
Structural formula:
Chemical structure

Related substances