Registration Dossier

Reference substances

Reference substances

IUPAC name:
(Z)-2-amino-α-(methoxyimino)thiazol-4-acetic acid

Inventory

EC number:
265-957-0
EC name:
(Z)-2-amino-α-(methoxyimino)thiazol-4-acetic acid
CAS number:
65872-41-5
CAS number:
65872-41-5
Synonyms
Names:
(2-amino-1,3-thiazol-4-yl)(methoxyimino)acetic acid

Molecular and structural information

Molecular formula:
C6H7N3O3S
Molecular weight:
201.203
SMILES notation:
CO\N=C(/C(=O)O)\c1csc(N)n1
InChl:
InChI=1/C6H7N3O3S/c1-12-9-4(5(10)11)3-2-13-6(7)8-3/h2H,1H3,(H2,7,8)(H,10,11)
Structural formula:
Chemical structure

Related substances