Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-benzyl-3-carbamoylpyridin-1-ium chloride

Inventory

EC number:
225-814-5
EC name:
1-benzyl-3-carbamoylpyridinium chloride
CAS number:
5096-13-9
CAS number:
5096-13-9
Synonyms
Names:
Pyridinium, 3-(aminocarbonyl)-1-(phenylmethyl)-, chloride
1-benzyl-3-carbamoylpyridinium chloride

Molecular and structural information

Molecular formula:
C13H13N2O.Cl
Molecular weight:
248.708
SMILES notation:
[Cl-].NC(=O)c1ccc[n+](Cc2ccccc2)c1
InChl:
InChI=1/C13H12N2O.ClH/c14-13(16)12-7-4-8-15(10-12)9-11-5-2-1-3-6-11;/h1-8,10H,9H2,(H-,14,16);1H
Structural formula:
Chemical structure

Related substances