Registration Dossier

Diss Factsheets

IUPAC name:
(S)-2-amino-1,1-diphenyl 1-propanol

Inventory

CAS number:
78603-91-5

Synonyms

Molecular and structural information

Molecular formula:
C15H17NO
Molecular weight:
ca. 227
SMILES notation:
C[C@H](N)C(O)(C1=CC=CC=C1)C1=CC=CC=C1
Structural formula:
Chemical structure

Related substances