Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,4-dimethoxyphenylacetonitrile

Inventory

EC number:
202-225-1
EC name:
3,4-dimethoxyphenylacetonitrile
CAS number:
93-17-4
CAS number:
93-17-4
Synonyms
Names:
3,4-dimethoxyphenylacetonitrile
(3,4-dimethoxyphenyl)acetonitrile

Molecular and structural information

Molecular formula:
C10H11NO2
Molecular weight:
177.2
SMILES notation:
COc1ccc(CC#N)cc1OC
InChl:
InChI=1/C10H11NO2/c1-12-9-4-3-8(5-6-11)7-10(9)13-2/h3-4,7H,5H2,1-2H3
Structural formula:
Chemical structure

Related substances