Registration Dossier

Diss Factsheets

IUPAC name:
5,6-diamino-1,3-dihydro-2H-benzimidazol-2-one

Inventory

EC number:
259-728-4
EC name:
1,3-dihydro-5,6-diamino-2H-benzimidazol-2-one
CAS number:
55621-49-3
CAS number:
55621-49-3

Synonyms

Molecular and structural information

Molecular formula:
C7H8N4O
Molecular weight:
164.165
SMILES notation:
Nc1cc2NC(=O)Nc2cc1N
InChl:
InChI=1/C7H8N4O/c8-3-1-5-6(2-4(3)9)11-7(12)10-5/h1-2H,8-9H2,(H2,10,11,12)
Structural formula:
Chemical structure

Related substances