Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,5-dinitrobenzoyl chloride

Inventory

EC number:
202-750-6
EC name:
3,5-dinitrobenzoyl chloride
CAS number:
99-33-2
CAS number:
99-33-2
Synonyms
Names:
Benzoyl chloride, 3,5-dinitro-
3,5-dinitrobenzoyl chloride

Molecular and structural information

Molecular formula:
C7H3ClN2O5
Molecular weight:
230.562
SMILES notation:
[O-][N+](=O)c1cc(cc(c1)[N+](=O)[O-])C(=O)Cl
InChl:
InChI=1/C7H3ClN2O5/c8-7(11)4-1-5(9(12)13)3-6(2-4)10(14)15/h1-3H
Structural formula:
Chemical structure

Related substances