Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,4-Bis(p-tolylamino)anthraquinone

Inventory

EC number:
204-909-5
EC name:
1,4-bis(p-tolylamino)anthraquinone
CAS number:
128-80-3
CAS number:
128-80-3

Synonyms

Molecular and structural information

Molecular formula:
C28H22N2O2
Molecular weight:
418.494
SMILES notation:
c12c(c(Nc3ccc(cc3)C)ccc1Nc1ccc(cc1)C)C(=O)c1c(C2=O)cccc1
InChl:
1S/C28H22N2O2/c1-17-7-11-19(12-8-17)29-23-15-16-24(30-20-13-9-18(2)10-14-20)26-25(23)27(31)21-5-3-4-6-22(21)28(26)32/h3-16,29-30H,1-2H3
Structural formula:
Chemical structure

Related substances