Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
pyridine-4-carboxylic acid

Inventory

EC number:
200-228-2
EC name:
Isonicotinic acid
CAS number:
55-22-1
CAS number:
55-22-1
Synonyms
Names:
4-Pyridinecarboxylic acid
Identifier:
CAS number
55-22-1
Identifier:
IUPAC name
4-Pyridinecarboxylic acid
Identifier:
IUPAC name
isonicotinic acid
Identifier:
IUPAC name
pyridine-4-carboxylic acid
Identifier:
PubChem
4-Carboxypyridine
Identifier:
PubChem
4-Picolinic acid
Identifier:
PubChem
4-Pyridinecarboxylic acid
Identifier:
PubChem
Acide iso-nicotinique
Identifier:
PubChem
Pyridine-4-carboxylic acid
Identifier:
PubChem
p-Pyridinecarboxylic acid
Identifier:
other: InChl
1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9)
Identifier:
other: SMILES notation
C1=CN=CC=C1C(=O)O
Identifier:
other: InChl
InChI=1/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9)
Identifier:
other: SMILES notation
OC(=O)c1ccncc1
pyridine-4-carboxylic acid

Molecular and structural information

Molecular formula:
C6H5NO2
Molecular weight:
>= 123.11 - <= 123.112
SMILES notation:
C1=CN=CC=C1C(=O)O
InChl:
InChI=1S/C6H5NO2/c8-6(9)5-1-3-7-4-2-5/h1-4H,(H,8,9)
Structural formula:
Chemical structure

Related substances