Registration Dossier

Reference substances

Reference substances

IUPAC name:
1-(2-benzoylethyl)piperidinium chloride

Inventory

EC number:
212-947-9
EC name:
1-(2-benzoylethyl)piperidinium chloride
CAS number:
886-06-6
CAS number:
886-06-6
Synonyms
Names:
1-(2-benzoylethyl)piperidinium_chloride
Identifier:
IUPAC name
1-(2-benzoylethyl)piperidinium chloride
1-(3-oxo-3-phenylpropyl)piperidinium chloride

Molecular and structural information

Molecular formula:
C14H19NO.ClH
Molecular weight:
253.768
SMILES notation:
[Cl-].O=C(CC[NH+]1CCCCC1)c2ccccc2
InChl:
InChI=1/C14H19NO.ClH/c16-14(13-7-3-1-4-8-13)9-12-15-10-5-2-6-11-15;/h1,3-4,7-8H,2,5-6,9-12H2;1H
Structural formula:
Chemical structure

Related substances