Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
3,5-dibromo-2-hydroxybenzaldehyde

Inventory

EC number:
202-003-4
EC name:
3,5-dibromo-2-hydroxybenzaldehyde
CAS number:
90-59-5
CAS number:
90-59-5
Synonyms
Names:
3,5-dibromo-2-hydroxybenzaldehyde
3,5-dibromo-2-hydroxybenzaldehyde

Molecular and structural information

Molecular formula:
C7H4Br2O2
Molecular weight:
279.913
SMILES notation:
Oc1c(Br)cc(Br)cc1C=O
InChl:
InChI=1/C7H4Br2O2/c8-5-1-4(3-10)7(11)6(9)2-5/h1-3,11H
Structural formula:
Chemical structure

Related substances