Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,3-dichloro-5-isocyanatobenzene

Inventory

EC number:
252-276-9
EC name:
1,3-dichloro-5-isocyanatobenzene
CAS number:
34893-92-0
CAS number:
34893-92-0
Synonyms
Names:
Benzene, 1,3-dichloro-5-isocyanato-
Identifier:
other: SMILES notation
C1=C(C=C(C=C1Cl)Cl)N=C=O
Identifier:
other: SMILES notation
Clc1cc(Cl)cc(c1)N=C=O
1,3-dichloro-5-isocyanatobenzene

Molecular and structural information

Molecular formula:
C7H3Cl2NO
Molecular weight:
188.01
SMILES notation:
O=C=Nc(cc(cc1Cl)Cl)c1
InChl:
InChI=1/C7H3Cl2NO/c8-5-1-6(9)3-7(2-5)10-4-11/h1-3H
Structural formula:
Chemical structure

Related substances