Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
rhodium;triphenylphosphane;chloride

Inventory

EC number:
238-744-5
EC name:
Tris(triphenylphosphine)rhodium (I) chloride
CAS number:
14694-95-2
CAS number:
14694-95-2

Synonyms

Molecular and structural information

Molecular formula:
C54H45ClP3Rh
Molecular weight:
925.21
SMILES notation:
C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3
=CC=CC=C3.C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=CC=CC=C3.[Cl-].[Rh]
Structural formula:
Chemical structure

Related substances