Registration Dossier

IUPAC name:
1-Butanone,4-[4-(4-chlorophenyl)-4-hydroxy-1-piperidinyl]-1-(4-fluorophenyl)-,hydrochloride

Inventory

CAS number:
1511-16-6

Synonyms

Molecular and structural information

Molecular formula:
C21 H23 Cl F N O2 HCl
Molecular weight:
ca. 412
SMILES notation:
OC2(CC[NH+](CCCC(=O)c1ccc(F)cc1)CC2)c3ccc(Cl)cc3
InChl:
InChI=1S/C21H23ClFNO2.ClH/c22-18-7-5-17(6-8-18)21(26)11-14-24(15-12-21)13-1-2-20(25)16-3-9-19(23)10-4-16;/h3-10,26H,1-2,11-15H2;1H
Structural formula:
Chemical structure

Related substances