Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
(3,4-dimethoxyphenyl)methanol

Inventory

EC number:
202-212-0
EC name:
3,4-dimethoxybenzyl alcohol
CAS number:
93-03-8
CAS number:
93-03-8
Synonyms
Names:
3,4-dimethoxybenzyl_alcohol
Benzenemethanol, 3,4-dimethoxy-
(3,4-dimethoxyphenyl)methanol

Molecular and structural information

Molecular formula:
C9H12O3
Molecular weight:
168.19
SMILES notation:
COc1ccc(CO)cc1OC
InChl:
InChI=1/C9H12O3/c1-11-8-4-3-7(6-10)5-9(8)12-2/h3-5,10H,6H2,1-2H3
Structural formula:
Chemical structure

Related substances

Categories Display