Registration Dossier

IUPAC name:
1-(4-chloro-phenyl)-2-methyl-but-3-en-1-ol

Inventory

CAS number:
123989-31-1

Synonyms

Molecular and structural information

Molecular formula:
C11H13ClO
Molecular weight:
196.7
SMILES notation:
C1(Cl)=CC=C(C(O)C(C)C=C)C=C1
Structural formula:
Chemical structure

Related substances