Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
potassium O-pentyl dithiocarbonate

Inventory

EC number:
220-329-5
EC name:
Potassium O-pentyl dithiocarbonate
CAS number:
2720-73-2
CAS number:
2720-73-2

Synonyms

Molecular and structural information

Molecular formula:
C6H12OS2.K
Molecular weight:
202.37
SMILES notation:
[K+].CCCCCOC(=S)[S-]
InChl:
InChI=1/C6H12OS2.K/c1-2-3-4-5-7-6(8)9;/h2-5H2,1H3,(H,8,9);/q;+1/p-1
Structural formula:
Chemical structure

Related substances