Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
deferoxamine

Inventory

EC number:
200-738-5
EC name:
Deferoxamine
CAS number:
70-51-9
CAS number:
70-51-9
Synonyms
Names:
N'-{5-[acetyl(hydroxy)amino]pentyl}-N-[5-({4-[(5-aminopentyl)(hydroxy)amino]-4-oxobutanoyl}amino)pentyl]-N-hydroxysuccinamide

Molecular and structural information

Molecular formula:
C25H48N6O8
Molecular weight:
560.684
SMILES notation:
CC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCNC(=O)CCC(=O)N(CCCCCN)O)O)O
InChl:
InChI=1S/C25H48N6O8/c1-21(32)29(37)18-9-3-6-16-27-22(33)12-14-25(36)31(39)20-10-4-7-17-28-23(34)11-13-24(35)30(38)19-8-2-5-15-26/h37-39H,2-20,26H2,1H3,(H,27,33)(H,28,34)
Structural formula:
Chemical structure

Related substances