Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
N,N,N-trimethylanilinium chloride

Inventory

EC number:
205-319-0
EC name:
N,N,N-trimethylanilinium chloride
CAS number:
138-24-9
CAS number:
138-24-9
Synonyms
Names:
Benzenaminium, N,N,N-trimethyl-, chloride

Molecular and structural information

Molecular formula:
C9H14N.Cl
Molecular weight:
171.667
SMILES notation:
[Cl-].C[N+](C)(C)c1ccccc1
InChl:
InChI=1/C9H14N.ClH/c1-10(2,3)9-7-5-4-6-8-9;/h4-8H,1-3H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances