Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
sodium octadec-9-enoate

Inventory

EC number:
205-591-0
EC name:
Sodium oleate
CAS number:
143-19-1
CAS number:
143-19-1
Synonyms
Names:
9-Octadecenoic acid (9Z)-, sodium salt
9-Octadecenoic acid (Z)-, sodium salt

Molecular and structural information

Molecular formula:
C18H34O2.Na
Molecular weight:
304.443
SMILES notation:
[Na+].CCCCCCCC\C=C/CCCCCCCC(=O)[O-]
InChl:
InChI=1/C18H34O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h9-10H,2-8,11-17H2,1H3,(H,19,20);/q;+1/p-1
Structural formula:
Chemical structure

Related substances

Categories Display