Registration Dossier

IUPAC name:
2-[(2-hydroxyethyl)(methyl)amino]-1-phenylpropan-1-ol

Inventory

CAS number:
91688-17-4

Synonyms

Molecular and structural information

Molecular formula:
C12H19NO2
Molecular weight:
ca. 209.3
SMILES notation:
CC(C(c1ccccc1)O)N(C)CCO
InChl:
InChI=1S/C12H19NO2/c1-10(13(2)8-9-14)12(15)11-6-4-3-5-7-11/h3-7,10,12,14-15H,8-9H2,1-2H3
Structural formula:
Chemical structure

Related substances