Registration Dossier

IUPAC name:
2-(4-chlorophenyl)-2-(1-cyclopropylethyl)-oxirane

Inventory

CAS number:
94361-26-9

Synonyms

Molecular and structural information

Molecular formula:
C13H15ClO
Molecular weight:
222.7
SMILES notation:
C1(C2(C(C)C3CC3)CO2)=CC=C(Cl)C=C1
Structural formula:
Chemical structure

Related substances