Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
4-decylbenzenesulfonic acid

Inventory

EC number:
205-422-0
EC name:
p-decylbenzenesulphonic acid
CAS number:
140-60-3
CAS number:
140-60-3
Synonyms
Names:
Benzenesulfonic acid, 4-decyl-
decyl benzenesulfonic acid sec- decyl benzenesulfonic acid 4-[sec-decanyl] benzenesulfonic acid 4-[decan-(2 to 5)-yl] benzenesulfonate 4-[sec-decanyl] benzenesulfonate
Identifier:
IUPAC name
4-[decan-(2 to 5)-yl] benzenesulfonic acid
Identifier:
other: SMILES notation
not applicable (generic description of constitutional isomers)
Identifier:
other: InChl
not applicable (generic description of constitutional isomers)

Molecular and structural information

Molecular formula:
C16H26O3S
Molecular weight:
298.441
SMILES notation:
CCCCCCCCCCc1ccc(cc1)S(=O)(=O)O
InChl:
InChI=1/C16H26O3S/c1-2-3-4-5-6-7-8-9-10-15-11-13-16(14-12-15)20(17,18)19/h11-14H,2-10H2,1H3,(H,17,18,19)
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
31093-47-7