Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,4-dimethyl-1-vinylbenzene

Inventory

EC number:
218-781-3
EC name:
4-vinyl-m-xylene
CAS number:
2234-20-0
CAS number:
2234-20-0
Synonyms
Names:
4-vinyl-m-xylene

Molecular and structural information

Molecular formula:
C10H12
Molecular weight:
132.202
SMILES notation:
Cc1ccc(C=C)c(C)c1
InChl:
InChI=1/C10H12/c1-4-10-6-5-8(2)7-9(10)3/h4-7H,1H2,2-3H3
Structural formula:
Chemical structure

Related substances