Registration Dossier

IUPAC name:
(1R,4R,5S)-6,6-dimethyl-4-(tribromomethyl)-3-oxabicyclo[3.1.0]hexan-2-one

Inventory

CAS number:
87305-03-1

Synonyms

Molecular and structural information

Molecular formula:
C8H9Br3O2
Molecular weight:
376
SMILES notation:
O1C(=O)C2C(C)(C)C2C1(C(Br)(Br)Br)
InChl:
(1R,4R,5S)-6,6-dimethyl-4-(tribromomethyl)-3-oxabicyclo[3.1.0]hexan-2-one
Structural formula:
Chemical structure

Related substances