Registration Dossier

General information

Inventory

EC number:
200-773-6
EC name:
L-valine
CAS number:
72-18-4

No inventory information available

Reference substance information

IUPAC name:
(2S)-2-amino-3-methylbutanoic acid
Synonyms
Names:
(+)-2-Amino-3-methylbutyric acid
(2S)-2-Amino-3-methylbutanoic acid
(S)-2-Amino-3-methylbutanoic acid
(S)-2-Amino-3-methylbutyric acid
(S)-Valine
(S)-α-Amino-β-methylbutyric acid
2-Amino-3-methylbutanoic acid
2-Amino-3-methylbutyric acid
Butanoic acid, 2-amino-3-methyl-, (S)-
L-(+)-α-Aminoisovaleric acid
L-Valine
L-α-Amino-β-methylbutyric acid
Valine
Identifier:
CAS number
72-18-4
L-valine

CAS information

CAS number:
72-18-4

Molecular and structural information

Molecular formula:
C5H11NO2
Molecular weight:
117.146
SMILES notation:
CC(C)[C@H](N)C(=O)O
InChl:
InChI=1/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8)
Structural formula:
Chemical structure