Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,4-Dimethyl-4-vinylcyclohexene

Inventory

EC number:
217-114-3
EC name:
1,4-dimethyl-4-vinylcyclohexene
CAS number:
1743-61-9
CAS number:
1743-61-9

Synonyms

Molecular and structural information

Molecular formula:
C10H16
Molecular weight:
136.234
SMILES notation:
CC1=CCC(C)(CC1)C=C
InChl:
InChI=1/C10H16/c1-4-10(3)7-5-9(2)6-8-10/h4-5H,1,6-8H2,2-3H3
Structural formula:
Chemical structure

Related substances